C25H30O5 — CID 70604658
diethyl 2-(oxolan-2-ylmethyl)-2-[(4-phenylphenyl)methyl]propanedioate (PubChem CID 70604658) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is diethyl 2-(oxolan-2-ylmethyl)-2-[(4-phenylphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-(oxolan-2-ylmethyl)-2-[(4-phenylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 70604658 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | diethyl 2-(oxolan-2-ylmethyl)-2-[(4-phenylphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc(-c2ccccc2)cc1)(CC1CCCO1)C(=O)OCC |
| InChI | InChI=1S/C25H30O5/c1-3-28-23(26)25(24(27)29-4-2,18-22-11-8-16-30-22)17-19-12-14-21(15-13-19)20-9-6-5-7-10-20/h5-7,9-10,12-15,22H,3-4,8,11,16-18H2,1-2H3 |
| InChIKey | KTEPZAYOHRRDGP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|