C23H26N6O3S — CID 70604790
2-butoxy-N-[(5S)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]naphthalene-1-carboxamide (PubChem CID 70604790) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-butoxy-N-[(5S)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]naphthalene-1-carboxamide.
| Compound Name | 2-butoxy-N-[(5S)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 70604790 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-butoxy-N-[(5S)-3,3-dimethyl-7-oxo-2-(2H-tetrazol-5-yl)-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]naphthalene-1-carboxamide |
| SMILES | CCCCOc1ccc2ccccc2c1C(=O)NC1C(=O)N2C(c3nn[nH]n3)C(C)(C)S[C@@H]12 |
| InChI | InChI=1S/C23H26N6O3S/c1-4-5-12-32-15-11-10-13-8-6-7-9-14(13)16(15)20(30)24-17-21(31)29-18(19-25-27-28-26-19)23(2,3)33-22(17)29/h6-11,17-18,22H,4-5,12H2,1-3H3,(H,24,30)(H,25,26,27,28)/t17?,18?,22-/m0/s1 |
| InChIKey | GXRXKTWZQVCUDW-IRZJEQJZSA-N |
| XLogP | 3.07 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|