C15H16O2 — CID 70607052
(2E)-2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneacetic acid (PubChem CID 70607052) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (2E)-2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneacetic acid.
| Compound Name | (2E)-2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneacetic acid |
|---|---|
| PubChem CID | 70607052 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2E)-2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneacetic acid |
| SMILES | O=C(O)/C=C1\CC2(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H16O2/c16-14(17)9-11-10-15(7-3-4-8-15)13-6-2-1-5-12(11)13/h1-2,5-6,9H,3-4,7-8,10H2,(H,16,17)/b11-9+ |
| InChIKey | RVQWYPIHHAEQTH-PKNBQFBNSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|