About 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride
1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride (PubChem CID 70607855) has the molecular formula C14H20ClFN2O2
and a molecular weight of 302.78 g/mol. Its IUPAC name is 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride |
| PubChem CID | 70607855 |
| Molecular Formula | C14H20ClFN2O2 |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride |
| SMILES | CCC(OC(=O)c1ccc(F)cc1)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H19FN2O2.ClH/c1-2-13(17-9-7-16-8-10-17)19-14(18)11-3-5-12(15)6-4-11;/h3-6,13,16H,2,7-10H2,1H3;1H |
| InChIKey | IILJRCDXKBEBPD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride?
The IUPAC name of 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride (CID 70607855) is 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride.
What is the SMILES notation for 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride?
The canonical SMILES for 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride is CCC(OC(=O)c1ccc(F)cc1)N1CCNCC1.Cl.
What is the InChIKey of 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride?
The InChIKey is IILJRCDXKBEBPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2O2.ClH/c1-2-13(17-9-7-16-8-10-17)19-14(18)11-3-5-12(15)6-4-11;/h3-6,13,16H,2,7-10H2,1H3;1H.
What are the key properties of 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride?
1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride has a molecular weight of 302.78 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-ylpropyl 4-fluorobenzoate;hydrochloride is sourced from PubChem (CID 70607855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).