C10H14N2O — CID 70609987
2,6-diamino-5-methylidene-4-prop-2-enylcyclohexa-1,3-dien-1-ol (PubChem CID 70609987) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2,6-diamino-5-methylidene-4-prop-2-enylcyclohexa-1,3-dien-1-ol.
| Compound Name | 2,6-diamino-5-methylidene-4-prop-2-enylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 70609987 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2,6-diamino-5-methylidene-4-prop-2-enylcyclohexa-1,3-dien-1-ol |
| SMILES | C=CCC1=CC(N)=C(O)C(N)C1=C |
| InChI | InChI=1S/C10H14N2O/c1-3-4-7-5-8(11)10(13)9(12)6(7)2/h3,5,9,13H,1-2,4,11-12H2 |
| InChIKey | FITPCALLVQHGLN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|