C21H28O7 — CID 70610290
2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-hydroxyprop-1-enyl]-2,4-dihydroxycyclopentyl]acetic acid (PubChem CID 70610290) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-hydroxyprop-1-enyl]-2,4-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-hydroxyprop-1-enyl]-2,4-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70610290 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-hydroxyprop-1-enyl]-2,4-dihydroxycyclopentyl]acetic acid |
| SMILES | COc1cc2c(cc1OC)C(C(C)=C(O)[C@]1(O)C[C@H](CC(=O)O)[C@H](O)C1)CC2 |
| InChI | InChI=1S/C21H28O7/c1-11(20(25)21(26)9-13(7-19(23)24)16(22)10-21)14-5-4-12-6-17(27-2)18(28-3)8-15(12)14/h6,8,13-14,16,22,25-26H,4-5,7,9-10H2,1-3H3,(H,23,24)/t13-,14?,16+,21-/m0/s1 |
| InChIKey | TYDHWIGXTOMPKK-ZTOWQUHCSA-N |
| XLogP | 2.54 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|