C31H44O9 — CID 70609863
2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-[(2R)-oxan-2-yl]oxyprop-1-enyl]-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]acetic acid (PubChem CID 70609863) has the molecular formula C31H44O9 and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-[(2R)-oxan-2-yl]oxyprop-1-enyl]-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-[(2R)-oxan-2-yl]oxyprop-1-enyl]-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70609863 |
| Molecular Formula | C31H44O9 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 2-[(1R,2R,4S)-4-[2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-1-[(2R)-oxan-2-yl]oxyprop-1-enyl]-2-hydroxy-4-(oxan-2-yloxy)cyclopentyl]acetic acid |
| SMILES | COc1cc2c(cc1OC)C(C(C)=C(O[C@@H]1CCCCO1)[C@]1(OC3CCCCO3)C[C@H](CC(=O)O)[C@H](O)C1)CC2 |
| InChI | InChI=1S/C31H44O9/c1-19(22-11-10-20-14-25(35-2)26(36-3)16-23(20)22)30(39-28-8-4-6-12-37-28)31(40-29-9-5-7-13-38-29)17-21(15-27(33)34)24(32)18-31/h14,16,21-22,24,28-29,32H,4-13,15,17-18H2,1-3H3,(H,33,34)/t21-,22?,24+,28+,29?,31-/m0/s1 |
| InChIKey | VSTKLNAOIOASLY-MCJNTBITSA-N |
| XLogP | 5.08 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|