C20H23NO5 — CID 70610761
[4-(2,2-dimethoxyethoxy)phenyl] N-phenyl-N-prop-1-enylcarbamate (PubChem CID 70610761) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [4-(2,2-dimethoxyethoxy)phenyl] N-phenyl-N-prop-1-enylcarbamate.
| Compound Name | [4-(2,2-dimethoxyethoxy)phenyl] N-phenyl-N-prop-1-enylcarbamate |
|---|---|
| PubChem CID | 70610761 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [4-(2,2-dimethoxyethoxy)phenyl] N-phenyl-N-prop-1-enylcarbamate |
| SMILES | CC=CN(C(=O)Oc1ccc(OCC(OC)OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO5/c1-4-14-21(16-8-6-5-7-9-16)20(22)26-18-12-10-17(11-13-18)25-15-19(23-2)24-3/h4-14,19H,15H2,1-3H3 |
| InChIKey | HQIRWJSXLJORTA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|