C22H23NO5 — CID 70616396
(Z)-but-2-enedioic acid;2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-1,3-dihydroisoindole (PubChem CID 70616396) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-1,3-dihydroisoindole.
| Compound Name | (Z)-but-2-enedioic acid;2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 70616396 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-1,3-dihydroisoindole |
| SMILES | COc1ccccc1/C=C/CN1Cc2ccccc2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H19NO.C4H4O4/c1-20-18-11-5-4-7-15(18)10-6-12-19-13-16-8-2-3-9-17(16)14-19;5-3(6)1-2-4(7)8/h2-11H,12-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b10-6+;2-1- |
| InChIKey | DQSONZGWRJIVLW-OCAIAXJTSA-N |
| XLogP | 3.44 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|