C16H20FNO3 — CID 84594370
methyl 3-fluoro-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylate (PubChem CID 84594370) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 3-fluoro-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 3-fluoro-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 84594370 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 3-fluoro-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(F)CCN(C/C=C/c2ccccc2OC)C1 |
| InChI | InChI=1S/C16H20FNO3/c1-20-14-8-4-3-6-13(14)7-5-10-18-11-9-16(17,12-18)15(19)21-2/h3-8H,9-12H2,1-2H3/b7-5+ |
| InChIKey | UOZKMCYWGIENRL-FNORWQNLSA-N |
| XLogP | 2.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |