C20H26O2 — CID 70617623
(3aS,3bR,9bS,11aR)-1-ethylidene-7-methoxy-11a-methyl-3b,4,5,9b,10,11-hexahydro-3aH-naphtho[1,2-g][1]benzofuran (PubChem CID 70617623) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (3aS,3bR,9bS,11aR)-1-ethylidene-7-methoxy-11a-methyl-3b,4,5,9b,10,11-hexahydro-3aH-naphtho[1,2-g][1]benzofuran.
| Compound Name | (3aS,3bR,9bS,11aR)-1-ethylidene-7-methoxy-11a-methyl-3b,4,5,9b,10,11-hexahydro-3aH-naphtho[1,2-g][1]benzofuran |
|---|---|
| PubChem CID | 70617623 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (3aS,3bR,9bS,11aR)-1-ethylidene-7-methoxy-11a-methyl-3b,4,5,9b,10,11-hexahydro-3aH-naphtho[1,2-g][1]benzofuran |
| SMILES | CC=C1CO[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H26O2/c1-4-14-12-22-19-18-7-5-13-11-15(21-3)6-8-16(13)17(18)9-10-20(14,19)2/h4,6,8,11,17-19H,5,7,9-10,12H2,1-3H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | DCBBZWBORXCGFU-YSTOQKLRSA-N |
| XLogP | 4.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|