C15H11N3OS — CID 706189
2-(1H-benzimidazol-2-ylmethylsulfanyl)-1,3-benzoxazole (PubChem CID 706189) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1,3-benzoxazole.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 706189 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1,3-benzoxazole |
| SMILES | c1ccc2[nH]c(CSc3nc4ccccc4o3)nc2c1 |
| InChI | InChI=1S/C15H11N3OS/c1-2-6-11-10(5-1)16-14(17-11)9-20-15-18-12-7-3-4-8-13(12)19-15/h1-8H,9H2,(H,16,17) |
| InChIKey | XWYBMWPWWXTZHA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |