C10H13N3 — CID 7061897
2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethanamine (PubChem CID 7061897) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethanamine.
| Compound Name | 2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethanamine |
|---|---|
| PubChem CID | 7061897 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethanamine |
| SMILES | Cc1cccn2cc(CCN)nc12 |
| InChI | InChI=1S/C10H13N3/c1-8-3-2-6-13-7-9(4-5-11)12-10(8)13/h2-3,6-7H,4-5,11H2,1H3 |
| InChIKey | UQHSMFRHNGALMY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |