C14H20N4O4 — CID 70620131
acetic acid;2-[(4,7-dimethoxy-2,3-dihydroinden-1-ylidene)amino]guanidine (PubChem CID 70620131) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is acetic acid;2-[(4,7-dimethoxy-2,3-dihydroinden-1-ylidene)amino]guanidine.
| Compound Name | acetic acid;2-[(4,7-dimethoxy-2,3-dihydroinden-1-ylidene)amino]guanidine |
|---|---|
| PubChem CID | 70620131 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | acetic acid;2-[(4,7-dimethoxy-2,3-dihydroinden-1-ylidene)amino]guanidine |
| SMILES | CC(=O)O.COc1ccc(OC)c2c1CCC2=NN=C(N)N |
| InChI | InChI=1S/C12H16N4O2.C2H4O2/c1-17-9-5-6-10(18-2)11-7(9)3-4-8(11)15-16-12(13)14;1-2(3)4/h5-6H,3-4H2,1-2H3,(H4,13,14,16);1H3,(H,3,4) |
| InChIKey | JACSYOFHZPZKHD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|