C11H17Cl2IN4 — CID 70620732
1-[2-amino-1-(2,6-dichlorophenyl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 70620732) has the molecular formula C11H17Cl2IN4 and a molecular weight of 403.10 g/mol. Its IUPAC name is 1-[2-amino-1-(2,6-dichlorophenyl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-amino-1-(2,6-dichlorophenyl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 70620732 |
| Molecular Formula | C11H17Cl2IN4 |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 1-[2-amino-1-(2,6-dichlorophenyl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\N)N(C)C(CN)c1c(Cl)cccc1Cl.I |
| InChI | InChI=1S/C11H16Cl2N4.HI/c1-16-11(15)17(2)9(6-14)10-7(12)4-3-5-8(10)13;/h3-5,9H,6,14H2,1-2H3,(H2,15,16);1H |
| InChIKey | YDPUUZWUKYKAKZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|