C16H24O4 — CID 70620987
methyl 7-[(1R,2S)-2-[(E)-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoate (PubChem CID 70620987) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-[(E)-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoate.
| Compound Name | methyl 7-[(1R,2S)-2-[(E)-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoate |
|---|---|
| PubChem CID | 70620987 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl 7-[(1R,2S)-2-[(E)-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C=C[C@@H]1/C=C/CO |
| InChI | InChI=1S/C16H24O4/c1-20-16(19)9-5-3-2-4-8-14-13(7-6-12-17)10-11-15(14)18/h6-7,10-11,13-14,17H,2-5,8-9,12H2,1H3/b7-6+/t13-,14+/m0/s1 |
| InChIKey | HJFXONGIFCRPOE-HYLRALAJSA-N |
| XLogP | 2.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|