C11H16O6S — CID 70623007
2-phenoxypent-4-en-2-ol;sulfuric acid (PubChem CID 70623007) has the molecular formula C11H16O6S and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-phenoxypent-4-en-2-ol;sulfuric acid.
| Compound Name | 2-phenoxypent-4-en-2-ol;sulfuric acid |
|---|---|
| PubChem CID | 70623007 |
| Molecular Formula | C11H16O6S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-phenoxypent-4-en-2-ol;sulfuric acid |
| SMILES | C=CCC(C)(O)Oc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C11H14O2.H2O4S/c1-3-9-11(2,12)13-10-7-5-4-6-8-10;1-5(2,3)4/h3-8,12H,1,9H2,2H3;(H2,1,2,3,4) |
| InChIKey | MNNAVQDKXISDTD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|