C22H26N2O6S — CID 70623147
propan-2-yl N-[4-[2-[(2-prop-2-enoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate (PubChem CID 70623147) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is propan-2-yl N-[4-[2-[(2-prop-2-enoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate.
| Compound Name | propan-2-yl N-[4-[2-[(2-prop-2-enoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 70623147 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | propan-2-yl N-[4-[2-[(2-prop-2-enoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate |
| SMILES | C=CCOc1ccccc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O6S/c1-4-15-29-20-8-6-5-7-19(20)21(25)23-14-13-17-9-11-18(12-10-17)31(27,28)24-22(26)30-16(2)3/h4-12,16H,1,13-15H2,2-3H3,(H,23,25)(H,24,26) |
| InChIKey | XEXNFVWVKRKJAV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|