C25H30N4O4S — CID 131856754
2-ethoxy-N-[2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]ethyl]benzamide (PubChem CID 131856754) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]ethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 131856754 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-ethoxy-N-[2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]ethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCc1ccc(S(=O)(=O)Nc2ncc(CC(C)C)cn2)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c1-4-33-23-8-6-5-7-22(23)24(30)26-14-13-19-9-11-21(12-10-19)34(31,32)29-25-27-16-20(17-28-25)15-18(2)3/h5-12,16-18H,4,13-15H2,1-3H3,(H,26,30)(H,27,28,29) |
| InChIKey | WPDXLRZYXHMUPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |