C19H20Cl2O3 — CID 70623178
ethyl 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]butanoate (PubChem CID 70623178) has the molecular formula C19H20Cl2O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is ethyl 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]butanoate.
| Compound Name | ethyl 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 70623178 |
| Molecular Formula | C19H20Cl2O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | ethyl 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]butanoate |
| SMILES | CCOC(=O)C(CC)Oc1ccc(Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2O3/c1-3-18(19(22)23-4-2)24-16-9-5-13(6-10-16)11-14-7-8-15(20)12-17(14)21/h5-10,12,18H,3-4,11H2,1-2H3 |
| InChIKey | UQKANWHCFCLOHQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |