C10H8N2O2S — CID 70626224
6-(2-sulfanylphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 70626224) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 6-(2-sulfanylphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(2-sulfanylphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70626224 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 6-(2-sulfanylphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(-c2ccccc2S)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H8N2O2S/c13-9-5-7(11-10(14)12-9)6-3-1-2-4-8(6)15/h1-5,15H,(H2,11,12,13,14) |
| InChIKey | VCQQTOABIWABIK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|