C7H8ClNO — CID 70626997
4-imino-3-methylcyclohexa-2,5-dien-1-one;hydrochloride (PubChem CID 70626997) has the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. Its IUPAC name is 4-imino-3-methylcyclohexa-2,5-dien-1-one;hydrochloride.
| Compound Name | 4-imino-3-methylcyclohexa-2,5-dien-1-one;hydrochloride |
|---|---|
| PubChem CID | 70626997 |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 4-imino-3-methylcyclohexa-2,5-dien-1-one;hydrochloride |
| SMILES | Cl.[H]/N=C1\C=CC(=O)C=C1C |
| InChI | InChI=1S/C7H7NO.ClH/c1-5-4-6(9)2-3-7(5)8;/h2-4,8H,1H3;1H/b8-7+; |
| InChIKey | WUMUIDFCFBFFTD-USRGLUTNSA-N |
| XLogP | 1.51 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|