C11H19N5O3 — CID 70627639
3-nitro-2-N-(1-propan-2-yloxypropyl)pyridine-2,4,6-triamine (PubChem CID 70627639) has the molecular formula C11H19N5O3 and a molecular weight of 269.31 g/mol. Its IUPAC name is 3-nitro-2-N-(1-propan-2-yloxypropyl)pyridine-2,4,6-triamine.
| Compound Name | 3-nitro-2-N-(1-propan-2-yloxypropyl)pyridine-2,4,6-triamine |
|---|---|
| PubChem CID | 70627639 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-nitro-2-N-(1-propan-2-yloxypropyl)pyridine-2,4,6-triamine |
| SMILES | CCC(Nc1nc(N)cc(N)c1[N+](=O)[O-])OC(C)C |
| InChI | InChI=1S/C11H19N5O3/c1-4-9(19-6(2)3)15-11-10(16(17)18)7(12)5-8(13)14-11/h5-6,9H,4H2,1-3H3,(H5,12,13,14,15) |
| InChIKey | NSDLXSMRISTIQU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|