C21H26N2O6 — CID 70628020
N-[(2R)-2-[[(2R)-2-hydroxy-2-phenylethyl]amino]propyl]-2-phenylacetamide;oxalic acid (PubChem CID 70628020) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[(2R)-2-[[(2R)-2-hydroxy-2-phenylethyl]amino]propyl]-2-phenylacetamide;oxalic acid.
| Compound Name | N-[(2R)-2-[[(2R)-2-hydroxy-2-phenylethyl]amino]propyl]-2-phenylacetamide;oxalic acid |
|---|---|
| PubChem CID | 70628020 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[(2R)-2-[[(2R)-2-hydroxy-2-phenylethyl]amino]propyl]-2-phenylacetamide;oxalic acid |
| SMILES | C[C@H](CNC(=O)Cc1ccccc1)NC[C@H](O)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O2.C2H2O4/c1-15(20-14-18(22)17-10-6-3-7-11-17)13-21-19(23)12-16-8-4-2-5-9-16;3-1(4)2(5)6/h2-11,15,18,20,22H,12-14H2,1H3,(H,21,23);(H,3,4)(H,5,6)/t15-,18+;/m1./s1 |
| InChIKey | RVLBRWXVFJWIML-CFILVAQYSA-N |
| XLogP | 1.21 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|