C25H30O5 — CID 70628318
[(8S,9S,10S,13S,14S,17S)-13-methyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 70628318) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17S)-13-methyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [(8S,9S,10S,13S,14S,17S)-13-methyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 70628318 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17S)-13-methyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CCC(=O)C=C1C=C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C3=CC(=O)OC3)CC[C@@H]12 |
| InChI | InChI=1S/C25H30O5/c1-15(26)30-14-25-10-7-18(27)12-17(25)3-4-19-21-6-5-20(16-11-23(28)29-13-16)24(21,2)9-8-22(19)25/h3-4,11-12,19-22H,5-10,13-14H2,1-2H3/t19-,20+,21-,22-,24+,25+/m0/s1 |
| InChIKey | DMNPGZJHYDSBQG-TYVAUTLRSA-N |
| XLogP | 3.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |