C22H30ClN3O7 — CID 70628409
but-2-enedioic acid;1-[1-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-1,3-diazinan-2-one (PubChem CID 70628409) has the molecular formula C22H30ClN3O7 and a molecular weight of 483.95 g/mol. Its IUPAC name is but-2-enedioic acid;1-[1-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-1,3-diazinan-2-one.
| Compound Name | but-2-enedioic acid;1-[1-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 70628409 |
| Molecular Formula | C22H30ClN3O7 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | but-2-enedioic acid;1-[1-[3-(2-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-1,3-diazinan-2-one |
| SMILES | O=C(O)C=CC(=O)O.O=C1NCCCN1C1CCN(CC(O)COc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H26ClN3O3.C4H4O4/c19-16-4-1-2-5-17(16)25-13-15(23)12-21-10-6-14(7-11-21)22-9-3-8-20-18(22)24;5-3(6)1-2-4(7)8/h1-2,4-5,14-15,23H,3,6-13H2,(H,20,24);1-2H,(H,5,6)(H,7,8) |
| InChIKey | OOFDJYBTDDDSOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|