About sodium;propan-1-ol;4-propoxycarbonylphenolate
sodium;propan-1-ol;4-propoxycarbonylphenolate (PubChem CID 70628571) has the molecular formula C13H19NaO4
and a molecular weight of 262.28 g/mol. Its IUPAC name is sodium;propan-1-ol;4-propoxycarbonylphenolate.
Molecular Properties
| Compound Name | sodium;propan-1-ol;4-propoxycarbonylphenolate |
| PubChem CID | 70628571 |
| Molecular Formula | C13H19NaO4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | sodium;propan-1-ol;4-propoxycarbonylphenolate |
| SMILES | CCCO.CCCOC(=O)c1ccc([O-])cc1.[Na+] |
| InChI | InChI=1S/C10H12O3.C3H8O.Na/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-2-3-4;/h3-6,11H,2,7H2,1H3;4H,2-3H2,1H3;/q;;+1/p-1 |
| InChIKey | DMHJFUKGWIOHSP-UHFFFAOYSA-M |
| XLogP | -1.28 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;propan-1-ol;4-propoxycarbonylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;propan-1-ol;4-propoxycarbonylphenolate?
The IUPAC name of sodium;propan-1-ol;4-propoxycarbonylphenolate (CID 70628571) is sodium;propan-1-ol;4-propoxycarbonylphenolate.
What is the SMILES notation for sodium;propan-1-ol;4-propoxycarbonylphenolate?
The canonical SMILES for sodium;propan-1-ol;4-propoxycarbonylphenolate is CCCO.CCCOC(=O)c1ccc([O-])cc1.[Na+].
What is the InChIKey of sodium;propan-1-ol;4-propoxycarbonylphenolate?
The InChIKey is DMHJFUKGWIOHSP-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12O3.C3H8O.Na/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-2-3-4;/h3-6,11H,2,7H2,1H3;4H,2-3H2,1H3;/q;;+1/p-1.
What are the key properties of sodium;propan-1-ol;4-propoxycarbonylphenolate?
sodium;propan-1-ol;4-propoxycarbonylphenolate has a molecular weight of 262.28 g/mol, XLogP of -1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;propan-1-ol;4-propoxycarbonylphenolate is sourced from PubChem (CID 70628571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).