C18H24O6 — CID 70628959
bis(cyclopropylmethyl) 2-butoxyfuran-3,4-dicarboxylate (PubChem CID 70628959) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is bis(cyclopropylmethyl) 2-butoxyfuran-3,4-dicarboxylate.
| Compound Name | bis(cyclopropylmethyl) 2-butoxyfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 70628959 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | bis(cyclopropylmethyl) 2-butoxyfuran-3,4-dicarboxylate |
| SMILES | CCCCOc1occ(C(=O)OCC2CC2)c1C(=O)OCC1CC1 |
| InChI | InChI=1S/C18H24O6/c1-2-3-8-21-18-15(17(20)23-10-13-6-7-13)14(11-24-18)16(19)22-9-12-4-5-12/h11-13H,2-10H2,1H3 |
| InChIKey | YQITUJLGGUQAQM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|