C15H25NO4 — CID 70629158
benzene-1,3-diol;ethyl N,N-dipropylcarbamate (PubChem CID 70629158) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is benzene-1,3-diol;ethyl N,N-dipropylcarbamate.
| Compound Name | benzene-1,3-diol;ethyl N,N-dipropylcarbamate |
|---|---|
| PubChem CID | 70629158 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | benzene-1,3-diol;ethyl N,N-dipropylcarbamate |
| SMILES | CCCN(CCC)C(=O)OCC.Oc1cccc(O)c1 |
| InChI | InChI=1S/C9H19NO2.C6H6O2/c1-4-7-10(8-5-2)9(11)12-6-3;7-5-2-1-3-6(8)4-5/h4-8H2,1-3H3;1-4,7-8H |
| InChIKey | JVXMAIIMQSFJGT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |