C29H46O5 — CID 70629300
[(7R,8R,9S,10S,13S,14S,17R)-17-[(R)-cyclopentyloxy(methoxy)methyl]-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70629300) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is [(7R,8R,9S,10S,13S,14S,17R)-17-[(R)-cyclopentyloxy(methoxy)methyl]-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,10S,13S,14S,17R)-17-[(R)-cyclopentyloxy(methoxy)methyl]-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70629300 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | [(7R,8R,9S,10S,13S,14S,17R)-17-[(R)-cyclopentyloxy(methoxy)methyl]-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CO[C@H](OC1CCCC1)[C@@]1(OC(C)=O)CC[C@H]2[C@@H]3[C@H](C)CC4=CCCC[C@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H46O5/c1-19-17-21-9-7-8-14-28(21,18-30)24-12-15-27(3)23(25(19)24)13-16-29(27,34-20(2)31)26(32-4)33-22-10-5-6-11-22/h9,19,22-26,30H,5-8,10-18H2,1-4H3/t19-,23+,24+,25+,26-,27+,28-,29+/m1/s1 |
| InChIKey | IMYJEGUIWMCFPZ-QSHGMWHDSA-N |
| XLogP | 5.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|