C28H42O4 — CID 22797475
[(7R,8R,9S,10S,13S,14S,17S)-17-(cyclopenten-1-yloxymethyl)-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 22797475) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is [(7R,8R,9S,10S,13S,14S,17S)-17-(cyclopenten-1-yloxymethyl)-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,10S,13S,14S,17S)-17-(cyclopenten-1-yloxymethyl)-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 22797475 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | [(7R,8R,9S,10S,13S,14S,17S)-17-(cyclopenten-1-yloxymethyl)-10-(hydroxymethyl)-7,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@]1(COC2=CCCC2)CC[C@H]2[C@@H]3[C@H](C)CC4=CCCC[C@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H42O4/c1-19-16-21-8-6-7-13-27(21,17-29)24-11-14-26(3)23(25(19)24)12-15-28(26,32-20(2)30)18-31-22-9-4-5-10-22/h8-9,19,23-25,29H,4-7,10-18H2,1-3H3/t19-,23+,24+,25+,26+,27-,28-/m1/s1 |
| InChIKey | DRXIXGMLUWXPSY-QENQPQICSA-N |
| XLogP | 5.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|