C23H34O6 — CID 67877409
2-[(8R,9R,10R,13S,14S)-17-acetyloxy-3,7-dihydroxy-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 67877409) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-[(8R,9R,10R,13S,14S)-17-acetyloxy-3,7-dihydroxy-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(8R,9R,10R,13S,14S)-17-acetyloxy-3,7-dihydroxy-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 67877409 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[(8R,9R,10R,13S,14S)-17-acetyloxy-3,7-dihydroxy-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | CC(=O)OC1(CC(=O)O)CC[C@H]2[C@@H]3C(O)CC4CC(O)C=C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H34O6/c1-13(24)29-23(12-19(27)28)9-6-17-20-16(5-8-22(17,23)3)21(2)7-4-15(25)10-14(21)11-18(20)26/h4,7,14-18,20,25-26H,5-6,8-12H2,1-3H3,(H,27,28)/t14?,15?,16-,17+,18?,20-,21+,22+,23?/m1/s1 |
| InChIKey | BRXRMZASRVAYBK-GHDKQRMOSA-N |
| XLogP | 2.91 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|