C19H28FNO2 — CID 90715147
(8R,9R,10R,13S,14S)-16-fluoro-17-imino-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7-diol (PubChem CID 90715147) has the molecular formula C19H28FNO2 and a molecular weight of 321.44 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-16-fluoro-17-imino-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (8R,9R,10R,13S,14S)-16-fluoro-17-imino-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 90715147 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (8R,9R,10R,13S,14S)-16-fluoro-17-imino-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7-diol |
| SMILES | [H]/N=C1\C(F)C[C@H]2[C@@H]3C(O)CC4CC(O)C=C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C19H28FNO2/c1-18-5-3-11(22)7-10(18)8-15(23)16-12(18)4-6-19(2)13(16)9-14(20)17(19)21/h3,5,10-16,21-23H,4,6-9H2,1-2H3/b21-17+/t10?,11?,12-,13+,14?,15?,16-,18+,19+/m1/s1 |
| InChIKey | XHNBFUYIEWORAP-MWIXEWQCSA-N |
| XLogP | 3.10 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|