C35H50O3 — CID 70605914
(8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(cyclopenten-1-yloxymethyl)-13,17-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 70605914) has the molecular formula C35H50O3 and a molecular weight of 518.78 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(cyclopenten-1-yloxymethyl)-13,17-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(cyclopenten-1-yloxymethyl)-13,17-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 70605914 |
| Molecular Formula | C35H50O3 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | (8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(cyclopenten-1-yloxymethyl)-13,17-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CC1(OC2=CCCC2)CC[C@H]2[C@@H]3CC=C4CC(OC5=CCCC5)CC[C@]4(COC4=CCCC4)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C35H50O3/c1-33-20-18-32-30(31(33)19-21-34(33,2)38-28-13-7-8-14-28)16-15-25-23-29(37-27-11-5-6-12-27)17-22-35(25,32)24-36-26-9-3-4-10-26/h9,11,13,15,29-32H,3-8,10,12,14,16-24H2,1-2H3/t29?,30-,31-,32+,33-,34?,35+/m0/s1 |
| InChIKey | LOASRMBZAJAHRD-RPFZFOSMSA-N |
| XLogP | 9.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|