C39H72O3Si — CID 67723695
[(8R,9R,10S,13S,14S)-17-ethoxy-17-hexyl-13-methyl-3-tributylsilyloxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methanol (PubChem CID 67723695) has the molecular formula C39H72O3Si and a molecular weight of 617.09 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-17-ethoxy-17-hexyl-13-methyl-3-tributylsilyloxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methanol.
| Compound Name | [(8R,9R,10S,13S,14S)-17-ethoxy-17-hexyl-13-methyl-3-tributylsilyloxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methanol |
|---|---|
| PubChem CID | 67723695 |
| Molecular Formula | C39H72O3Si |
| Molecular Weight | 617.09 g/mol |
| Exact Mass | 616.53 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-17-ethoxy-17-hexyl-13-methyl-3-tributylsilyloxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methanol |
| SMILES | CCCCCCC1(OCC)CC[C@H]2[C@@H]3CC=C4CC(O[Si](CCCC)(CCCC)CCCC)CC[C@]4(CO)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C39H72O3Si/c1-7-12-16-17-23-39(41-11-5)26-22-35-34-19-18-32-30-33(20-25-38(32,31-40)36(34)21-24-37(35,39)6)42-43(27-13-8-2,28-14-9-3)29-15-10-4/h18,33-36,40H,7-17,19-31H2,1-6H3/t33?,34-,35-,36+,37-,38+,39?/m0/s1 |
| InChIKey | KXGHVFSYFXWEBN-WPNQGIMPSA-N |
| XLogP | 11.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.09 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|