C21H27N3O9 — CID 166626741
[(3S,8R,9S,10S,13S,14S,17R)-17-ethynyl-13-methyl-3,17-dinitrooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl nitrate (PubChem CID 166626741) has the molecular formula C21H27N3O9 and a molecular weight of 465.46 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13S,14S,17R)-17-ethynyl-13-methyl-3,17-dinitrooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl nitrate.
| Compound Name | [(3S,8R,9S,10S,13S,14S,17R)-17-ethynyl-13-methyl-3,17-dinitrooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl nitrate |
|---|---|
| PubChem CID | 166626741 |
| Molecular Formula | C21H27N3O9 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [(3S,8R,9S,10S,13S,14S,17R)-17-ethynyl-13-methyl-3,17-dinitrooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl nitrate |
| SMILES | C#C[C@]1(O[N+](=O)[O-])CC[C@H]2[C@@H]3CC=C4C[C@@H](O[N+](=O)[O-])CC[C@]4(CO[N+](=O)[O-])[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H27N3O9/c1-3-21(33-24(29)30)11-8-17-16-5-4-14-12-15(32-23(27)28)6-10-20(14,13-31-22(25)26)18(16)7-9-19(17,21)2/h1,4,15-18H,5-13H2,2H3/t15-,16-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | OSUPKPPFCXJYBI-YGIASRBBSA-N |
| XLogP | 3.29 |
| TPSA | 157.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|