C25H40N2O5 — CID 58747657
[(3R,10R,13S,17S)-17-(3-hydroxy-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrate (PubChem CID 58747657) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is [(3R,10R,13S,17S)-17-(3-hydroxy-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrate.
| Compound Name | [(3R,10R,13S,17S)-17-(3-hydroxy-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrate |
|---|---|
| PubChem CID | 58747657 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | [(3R,10R,13S,17S)-17-(3-hydroxy-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrate |
| SMILES | CC1(C)COC(C)([C@H]2CCC3C4CC=C5C[C@H](O[N+](=O)[O-])CC[C@]5(C)C4CC[C@@]32C)N1O |
| InChI | InChI=1S/C25H40N2O5/c1-22(2)15-31-25(5,26(22)28)21-9-8-19-18-7-6-16-14-17(32-27(29)30)10-12-23(16,3)20(18)11-13-24(19,21)4/h6,17-21,28H,7-15H2,1-5H3/t17-,18?,19?,20?,21+,23+,24+,25?/m1/s1 |
| InChIKey | KUAVGQJFCALFHO-LGJRHIBQSA-N |
| XLogP | 5.36 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|