C31H46O3 — CID 70605415
(8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(methoxymethyl)-1,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 70605415) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(methoxymethyl)-1,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(methoxymethyl)-1,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 70605415 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | (8R,9R,10S,13S,14S)-3,17-di(cyclopenten-1-yloxy)-10-(methoxymethyl)-1,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | COC[C@]12C(=CC[C@@H]3[C@H]1CC[C@]1(C)C(OC4=CCCC4)CC[C@@H]31)CC(OC1=CCCC1)CC2C |
| InChI | InChI=1S/C31H46O3/c1-21-18-25(33-23-8-4-5-9-23)19-22-12-13-26-27-14-15-29(34-24-10-6-7-11-24)30(27,2)17-16-28(26)31(21,22)20-32-3/h8,10,12,21,25-29H,4-7,9,11,13-20H2,1-3H3/t21?,25?,26-,27-,28+,29?,30-,31-/m0/s1 |
| InChIKey | YXYITPWMNLHPTA-PHOQZUTRSA-N |
| XLogP | 7.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|