C29H44O3 — CID 88794503
(8S,9R,10S,13S,14S)-3-(cyclohexen-1-yloxy)-6,13-dimethyl-17-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 88794503) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-3-(cyclohexen-1-yloxy)-6,13-dimethyl-17-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (8S,9R,10S,13S,14S)-3-(cyclohexen-1-yloxy)-6,13-dimethyl-17-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 88794503 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (8S,9R,10S,13S,14S)-3-(cyclohexen-1-yloxy)-6,13-dimethyl-17-propoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CCCOC1CC[C@H]2[C@@H]3CC(C)=C4CC(OC5=CCCCC5)CC[C@]4(C=O)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C29H44O3/c1-4-16-31-27-11-10-24-23-17-20(2)26-18-22(32-21-8-6-5-7-9-21)12-15-29(26,19-30)25(23)13-14-28(24,27)3/h8,19,22-25,27H,4-7,9-18H2,1-3H3/t22?,23-,24-,25+,27?,28-,29-/m0/s1 |
| InChIKey | VKWZSSJXKFOGPE-WPLHGKRESA-N |
| XLogP | 7.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|