C26H46O3Si2 — CID 22806867
(1S,8R,9S,10S,13S,14S,17S)-1,13-dimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22806867) has the molecular formula C26H46O3Si2 and a molecular weight of 462.82 g/mol. Its IUPAC name is (1S,8R,9S,10S,13S,14S,17S)-1,13-dimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (1S,8R,9S,10S,13S,14S,17S)-1,13-dimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22806867 |
| Molecular Formula | C26H46O3Si2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (1S,8R,9S,10S,13S,14S,17S)-1,13-dimethyl-17-trimethylsilyloxy-10-(trimethylsilyloxymethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1CC(=O)CC2=CC[C@H]3[C@@H]4CC[C@H](O[Si](C)(C)C)[C@@]4(C)CC[C@@H]3[C@]21CO[Si](C)(C)C |
| InChI | InChI=1S/C26H46O3Si2/c1-18-15-20(27)16-19-9-10-21-22-11-12-24(29-31(6,7)8)25(22,2)14-13-23(21)26(18,19)17-28-30(3,4)5/h9,18,21-24H,10-17H2,1-8H3/t18-,21-,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | MYXCGPGOYSQVNO-NWIIOLSNSA-N |
| XLogP | 6.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|