C22H32O4 — CID 70605705
[(1R,8R,9S,10S,13S,14S,17S)-17-hydroxy-1,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 70605705) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1R,8R,9S,10S,13S,14S,17S)-17-hydroxy-1,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [(1R,8R,9S,10S,13S,14S,17S)-17-hydroxy-1,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 70605705 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1R,8R,9S,10S,13S,14S,17S)-17-hydroxy-1,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12C(=CC[C@H]3[C@@H]4CC[C@H](O)[C@@]4(C)CC[C@@H]31)CC(=O)C[C@H]2C |
| InChI | InChI=1S/C22H32O4/c1-13-10-16(24)11-15-4-5-17-18-6-7-20(25)21(18,3)9-8-19(17)22(13,15)12-26-14(2)23/h4,13,17-20,25H,5-12H2,1-3H3/t13-,17+,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey | ZABNPLSPKFLEDZ-JTIIFYKTSA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|