C22H21ClN2S — CID 70630028
1-[4-(4-chlorophenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylbut-3-enyl]imidazole (PubChem CID 70630028) has the molecular formula C22H21ClN2S and a molecular weight of 380.94 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylbut-3-enyl]imidazole.
| Compound Name | 1-[4-(4-chlorophenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylbut-3-enyl]imidazole |
|---|---|
| PubChem CID | 70630028 |
| Molecular Formula | C22H21ClN2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylbut-3-enyl]imidazole |
| SMILES | Clc1ccc(C=CC(Cn2ccnc2)SC/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21ClN2S/c23-21-11-8-20(9-12-21)10-13-22(17-25-15-14-24-18-25)26-16-4-7-19-5-2-1-3-6-19/h1-15,18,22H,16-17H2/b7-4+,13-10? |
| InChIKey | ZPINLPZTPVIGON-YQHBQRSUSA-N |
| XLogP | 6.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |