C22H38BrN — CID 70630635
1-prop-2-enyl-2-tetradecylpyridin-1-ium bromide (PubChem CID 70630635) has the molecular formula C22H38BrN and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-prop-2-enyl-2-tetradecylpyridin-1-ium bromide.
| Compound Name | 1-prop-2-enyl-2-tetradecylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 70630635 |
| Molecular Formula | C22H38BrN |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-prop-2-enyl-2-tetradecylpyridin-1-ium bromide |
| SMILES | C=CC[n+]1ccccc1CCCCCCCCCCCCCC.[Br-] |
| InChI | InChI=1S/C22H38N.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-22-19-16-17-21-23(22)20-4-2;/h4,16-17,19,21H,2-3,5-15,18,20H2,1H3;1H/q+1;/p-1 |
| InChIKey | OBOBHXDXHOWIFI-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|