C18H19Cl2NO3 — CID 70631739
(2,5-dichlorophenyl) 1-(N-ethyl-3-methylanilino)ethyl carbonate (PubChem CID 70631739) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is (2,5-dichlorophenyl) 1-(N-ethyl-3-methylanilino)ethyl carbonate.
| Compound Name | (2,5-dichlorophenyl) 1-(N-ethyl-3-methylanilino)ethyl carbonate |
|---|---|
| PubChem CID | 70631739 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (2,5-dichlorophenyl) 1-(N-ethyl-3-methylanilino)ethyl carbonate |
| SMILES | CCN(c1cccc(C)c1)C(C)OC(=O)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H19Cl2NO3/c1-4-21(15-7-5-6-12(2)10-15)13(3)23-18(22)24-17-11-14(19)8-9-16(17)20/h5-11,13H,4H2,1-3H3 |
| InChIKey | DFSAQQAEECNGJY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|