About 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate
4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 70633161) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate |
| PubChem CID | 70633161 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | CCN(c1cccc(C)c1)C(C)OC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-5-21(18-8-6-7-14(2)13-18)15(3)25-20(23)17-11-9-16(10-12-17)19(22)24-4/h6-13,15H,5H2,1-4H3 |
| InChIKey | VTLZYPYAABNVIR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate?
The IUPAC name of 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate (CID 70633161) is 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate.
What is the SMILES notation for 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate?
The canonical SMILES for 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate is CCN(c1cccc(C)c1)C(C)OC(=O)c1ccc(C(=O)OC)cc1.
What is the InChIKey of 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate?
The InChIKey is VTLZYPYAABNVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c1-5-21(18-8-6-7-14(2)13-18)15(3)25-20(23)17-11-9-16(10-12-17)19(22)24-4/h6-13,15H,5H2,1-4H3.
What are the key properties of 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate?
4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate has a molecular weight of 341.41 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[1-(N-ethyl-3-methylanilino)ethyl] 1-O-methyl benzene-1,4-dicarboxylate is sourced from PubChem (CID 70633161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).