About 1-(N-ethylanilino)ethyl 4-phenylbenzoate
1-(N-ethylanilino)ethyl 4-phenylbenzoate (PubChem CID 70632799) has the molecular formula C23H23NO2
and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-(N-ethylanilino)ethyl 4-phenylbenzoate.
Molecular Properties
| Compound Name | 1-(N-ethylanilino)ethyl 4-phenylbenzoate |
| PubChem CID | 70632799 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(N-ethylanilino)ethyl 4-phenylbenzoate |
| SMILES | CCN(c1ccccc1)C(C)OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2/c1-3-24(22-12-8-5-9-13-22)18(2)26-23(25)21-16-14-20(15-17-21)19-10-6-4-7-11-19/h4-18H,3H2,1-2H3 |
| InChIKey | QADBFUCNGZPXKT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(N-ethylanilino)ethyl 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N-ethylanilino)ethyl 4-phenylbenzoate?
The IUPAC name of 1-(N-ethylanilino)ethyl 4-phenylbenzoate (CID 70632799) is 1-(N-ethylanilino)ethyl 4-phenylbenzoate.
What is the SMILES notation for 1-(N-ethylanilino)ethyl 4-phenylbenzoate?
The canonical SMILES for 1-(N-ethylanilino)ethyl 4-phenylbenzoate is CCN(c1ccccc1)C(C)OC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-(N-ethylanilino)ethyl 4-phenylbenzoate?
The InChIKey is QADBFUCNGZPXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO2/c1-3-24(22-12-8-5-9-13-22)18(2)26-23(25)21-16-14-20(15-17-21)19-10-6-4-7-11-19/h4-18H,3H2,1-2H3.
What are the key properties of 1-(N-ethylanilino)ethyl 4-phenylbenzoate?
1-(N-ethylanilino)ethyl 4-phenylbenzoate has a molecular weight of 345.44 g/mol, XLogP of 5.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N-ethylanilino)ethyl 4-phenylbenzoate is sourced from PubChem (CID 70632799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).