About [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate
[4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate (PubChem CID 70632289) has the molecular formula C23H23NO5S
and a molecular weight of 425.51 g/mol. Its IUPAC name is [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate.
Molecular Properties
| Compound Name | [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate |
| PubChem CID | 70632289 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate |
| SMILES | CCN(c1ccccc1)C(C)OC(=O)Oc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-3-24(19-10-6-4-7-11-19)18(2)28-23(25)29-20-14-16-22(17-15-20)30(26,27)21-12-8-5-9-13-21/h4-18H,3H2,1-2H3 |
| InChIKey | LQXZESUSELZUED-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate?
The IUPAC name of [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate (CID 70632289) is [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate.
What is the SMILES notation for [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate?
The canonical SMILES for [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate is CCN(c1ccccc1)C(C)OC(=O)Oc1ccc(S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate?
The InChIKey is LQXZESUSELZUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO5S/c1-3-24(19-10-6-4-7-11-19)18(2)28-23(25)29-20-14-16-22(17-15-20)30(26,27)21-12-8-5-9-13-21/h4-18H,3H2,1-2H3.
What are the key properties of [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate?
[4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate has a molecular weight of 425.51 g/mol, XLogP of 4.91, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonyl)phenyl] 1-(N-ethylanilino)ethyl carbonate is sourced from PubChem (CID 70632289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).