About (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate
(3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate (PubChem CID 70632052) has the molecular formula C16H16ClNO3
and a molecular weight of 305.76 g/mol. Its IUPAC name is (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate.
Molecular Properties
| Compound Name | (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate |
| PubChem CID | 70632052 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate |
| SMILES | CC(OC(=O)Oc1cccc(Cl)c1)N(C)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO3/c1-12(18(2)14-8-4-3-5-9-14)20-16(19)21-15-10-6-7-13(17)11-15/h3-12H,1-2H3 |
| InChIKey | WLYPQGOQQDRPQT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate?
The IUPAC name of (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate (CID 70632052) is (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate.
What is the SMILES notation for (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate?
The canonical SMILES for (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate is CC(OC(=O)Oc1cccc(Cl)c1)N(C)c1ccccc1.
What is the InChIKey of (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate?
The InChIKey is WLYPQGOQQDRPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO3/c1-12(18(2)14-8-4-3-5-9-14)20-16(19)21-15-10-6-7-13(17)11-15/h3-12H,1-2H3.
What are the key properties of (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate?
(3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate has a molecular weight of 305.76 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) 1-(N-methylanilino)ethyl carbonate is sourced from PubChem (CID 70632052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).