C13H16F3NO3 — CID 70633501
2-[3-methoxy-N-(2,2,2-trifluoroethyl)anilino]ethyl acetate (PubChem CID 70633501) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[3-methoxy-N-(2,2,2-trifluoroethyl)anilino]ethyl acetate.
| Compound Name | 2-[3-methoxy-N-(2,2,2-trifluoroethyl)anilino]ethyl acetate |
|---|---|
| PubChem CID | 70633501 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[3-methoxy-N-(2,2,2-trifluoroethyl)anilino]ethyl acetate |
| SMILES | COc1cccc(N(CCOC(C)=O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-10(18)20-7-6-17(9-13(14,15)16)11-4-3-5-12(8-11)19-2/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | AZLLBCWSWHLJOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |