C28H39NO3 — CID 70636169
methyl 4-[[(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carbonyl]amino]benzoate (PubChem CID 70636169) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is methyl 4-[[(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 70636169 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | methyl 4-[[(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@]2(C)CCC[C@@]3(C)[C@H]2CC=C2CC(C(C)C)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C28H39NO3/c1-18(2)20-9-13-23-21(17-20)10-14-24-27(23,3)15-6-16-28(24,4)26(31)29-22-11-7-19(8-12-22)25(30)32-5/h7-8,10-12,18,20,23-24H,6,9,13-17H2,1-5H3,(H,29,31)/t20?,23-,24+,27+,28+/m0/s1 |
| InChIKey | SLTKTCAURKORQE-ITCSJXRFSA-N |
| XLogP | 6.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|